CAS 22106-57-6 appears in our catalog under these names: 1-(4-Amino-3-chloro-phenyl)-acetic acid, 98%, 2-(4-Amino-3-chlorophenyl)acetic acid 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg.
2-(4-amino-3-chlorophenyl)acetic acid (CAS 22106-57-6) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-(4-amino-3-chlorophenyl)acetic acid. InChIKey: RNPFHSPLVUBKAU-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-(4-amino-3-chlorophenyl)acetic acid |
| InChIKey | RNPFHSPLVUBKAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)Cl)N |
Computed by PubChem (NCBI)