CAS 25698-44-6 appears in our catalog under these names: (R)–2–Amino–2–(3–fluorophenyl)acetic acid, (R)-2-Amino-2-(3-fluorophenyl)acetic acid, 98%, 98%, (R)-2-Amino-2-(3-fluorophenyl)acetic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-2-amino-2-(3-fluorophenyl)acetic acid (CAS 25698-44-6) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: (2R)-2-amino-2-(3-fluorophenyl)acetic acid. InChIKey: LVYBCZIDQKJNFP-SSDOTTSWSA-N.
| Molecular formula | C8H8FNO2 |
|---|---|
| Molecular weight | 169.15 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-fluorophenyl)acetic acid |
| InChIKey | LVYBCZIDQKJNFP-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)