H-D-Trp-OEt.HCl, 97%, 97%
cas: 61535-49-7 — see every product listed under this CAS number, including other names
H-D-Trp-OEt.HCl, 97%, 97% (CAS 61535-49-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E04A-250mg |
| cas | 61535-49-7 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 100g | 213.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 61535-49-7) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: PESYCVVSLYSXAK-RFVHGSKJSA-N.
| Molecular formula | C13H17ClN2O2 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | PESYCVVSLYSXAK-RFVHGSKJSA-N |
| SMILES | CCOC(=O)[C@@H](CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Ethyl D-tryptophanate--hydrogen chloride (1/1), H-D-TRP-OET.HCL, D-Tryptophan ethyl ester hydrochloride, H-D-TRP-OET HCL, ethyl D-tryptophanate hydrochloride, ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride, H-D-Trp-oet hydrochloride, H-D-Trp-O-Et hydrochloride, (R)-Ethyl 2-amino-3-(1H-indol-3-yl)propanoate HCl, PESYCVVSLYSXAK-RFVHGSKJSA-N