Products 2307280-69-7

CAS 2307280-69-7 is the registry number for Benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;hydrochloride (CAS 2307280-69-7) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;hydrochloride. InChIKey: KKUKRVQUHVZMOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17ClN2O2
Molecular weight268.74 g/mol
IUPAC namebenzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;hydrochloride
InChIKeyKKUKRVQUHVZMOJ-UHFFFAOYSA-N
SMILESC1C2(CN1)CN(C2)C(=O)OCC3=CC=CC=C3.Cl

Computed by PubChem (NCBI)