CAS 2307280-69-7 is the registry number for Benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;hydrochloride (CAS 2307280-69-7) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;hydrochloride. InChIKey: KKUKRVQUHVZMOJ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O2 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;hydrochloride |
| InChIKey | KKUKRVQUHVZMOJ-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)