CAS 23218-76-0 appears in our catalog under these names: 2–Amino–3–(8–hydroxyquinolin–5–yl)propanoic acid dihydrochloride, 2-Amino-3-(8-hydroxyquinolin-5-yl)propanoic acid dihydrochloride, 97%, 97%, 2-AMINO-3-(8-HYDROXYQUINOLIN-5-YL)PROPANOIC ACID DIHYDROCHLORIDE, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-amino-3-(8-hydroxyquinolin-5-yl)propanoic acid;dihydrochloride (CAS 23218-76-0) is a chemical compound with the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.15 g/mol. IUPAC name: 2-amino-3-(8-hydroxyquinolin-5-yl)propanoic acid;dihydrochloride. InChIKey: SBPUWEPIAMQXCH-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O3 |
|---|---|
| Molecular weight | 305.15 g/mol |
| IUPAC name | 2-amino-3-(8-hydroxyquinolin-5-yl)propanoic acid;dihydrochloride |
| InChIKey | SBPUWEPIAMQXCH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)CC(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)