CAS 1123191-88-7 appears in our catalog under these names: 2-Amino-3-(8-hydroxyquinolin-3-yl)propanoic acid dihydrochloride, 95+%, rac (8-Hydroxyquinolin-3-yl)alanine Dihydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
2-amino-3-(8-hydroxyquinolin-3-yl)propanoic acid;dihydrochloride (CAS 1123191-88-7) is a chemical compound with the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.15 g/mol. IUPAC name: 2-amino-3-(8-hydroxyquinolin-3-yl)propanoic acid;dihydrochloride. InChIKey: YWOXMKIPAOEJMF-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O3 |
|---|---|
| Molecular weight | 305.15 g/mol |
| IUPAC name | 2-amino-3-(8-hydroxyquinolin-3-yl)propanoic acid;dihydrochloride |
| InChIKey | YWOXMKIPAOEJMF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)O)CC(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)