cas: 108607-02-9 — see every product listed under this CAS number, including other names
H-Glu(OtBu)-NH2·HCl, 98%, 98% (CAS 108607-02-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119UMG-250mg |
| cas | 108607-02-9 |
| size | 250mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 69.20 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 318.80 Pln | |
| Chemat | 50g | 558.80 Pln | |
| Chemat | 100g | 1029.20 Pln | |
| Chemat | 250g | 2406.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4S)-4,5-diamino-5-oxopentanoate;hydrochloride (CAS 108607-02-9) is a chemical compound with the molecular formula C9H19ClN2O3 and a molecular weight of 238.71 g/mol. IUPAC name: tert-butyl (4S)-4,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: NWLREMKEFHDCSV-RGMNGODLSA-N.
| Molecular formula | C9H19ClN2O3 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | tert-butyl (4S)-4,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | NWLREMKEFHDCSV-RGMNGODLSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)