CAS 108607-02-9 appears in our catalog under these names: H-Glu(otbu)-nh2 hydrochloride, >95% (HPLC), H–Glu(OtBu)–NH₂ · HCl, H-L-Glu(OtBu)-NH2*HCl, L-Glutamic acid gamma-tert-butyl ester alpha-amide hydrochloride, H-Glu(OtBu)-NH2·HCl, 98%, 98%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g, 50g, 100g.
Tert-butyl (4S)-4,5-diamino-5-oxopentanoate;hydrochloride (CAS 108607-02-9) is a chemical compound with the molecular formula C9H19ClN2O3 and a molecular weight of 238.71 g/mol. IUPAC name: tert-butyl (4S)-4,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: NWLREMKEFHDCSV-RGMNGODLSA-N.
| Molecular formula | C9H19ClN2O3 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | tert-butyl (4S)-4,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | NWLREMKEFHDCSV-RGMNGODLSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)