cas: 6234-26-0 — see every product listed under this CAS number, including other names
H-Gly-Gly-Phe-OH, 98%, 98% (CAS 6234-26-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EDHE-100mg |
| cas | 6234-26-0 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1576.40 Pln | |
| Chemat | 50g | 2334.80 Pln | |
| Chemat | 100g | 3851.60 Pln | |
| Chemat | 250g | 4485.20 Pln | |
| Chemat | 500g | 7507.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Gly-Gly-Phe is a tripeptide composed of glycine, glycine and L-phenylalanine residues joined in sequence. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoic acid |
| InChIKey | KAJAOGBVWCYGHZ-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)CNC(=O)CN |
Computed by PubChem (NCBI)