cas: 6234-26-0 — see every product listed under this CAS number, including other names
(S)-2-(2-(2-Aminoacetamido)acetamido)-3-phenylpropanoic acid, 95% (CAS 6234-26-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F324291-250MG |
| cas | 6234-26-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1091.30 Pln | |
| Fluorochem | 10g | 1747.32 Pln | |
| Fluorochem | 25g | 3439.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Gly-Gly-Phe is a tripeptide composed of glycine, glycine and L-phenylalanine residues joined in sequence. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoic acid |
| InChIKey | KAJAOGBVWCYGHZ-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)CNC(=O)CN |
Computed by PubChem (NCBI)