cas: 2812-28-4 — see every product listed under this CAS number, including other names
H-N-Me-Thr-OH 98% (CAS 2812-28-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A445756-100g |
| cas | 2812-28-4 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 19549.88 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1171.38 Pln | |
| Ambeed | 10g | 2244.94 Pln | |
| Ambeed | 25g | 5387.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A445756 |
(2S,3R)-3-hydroxy-2-(methylamino)butanoic acid (CAS 2812-28-4) is a chemical compound with the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. IUPAC name: (2S,3R)-3-hydroxy-2-(methylamino)butanoic acid. InChIKey: CCAIIPMIAFGKSI-DMTCNVIQSA-N.
| Molecular formula | C5H11NO3 |
|---|---|
| Molecular weight | 133.15 g/mol |
| IUPAC name | (2S,3R)-3-hydroxy-2-(methylamino)butanoic acid |
| InChIKey | CCAIIPMIAFGKSI-DMTCNVIQSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC)O |
Computed by PubChem (NCBI)