Products 4775-82-0

CAS 4775-82-0 is the registry number for (S)-2-Amino-3-ethoxy-propionic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg.

Structural formula: {0} (CAS {1})

(2S)-2-amino-3-ethoxypropanoic acid (CAS 4775-82-0) is a chemical compound with the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. IUPAC name: (2S)-2-amino-3-ethoxypropanoic acid. InChIKey: AFGCRUGTZPDWSF-BYPYZUCNSA-N.

Identity
Molecular formulaC5H11NO3
Molecular weight133.15 g/mol
IUPAC name(2S)-2-amino-3-ethoxypropanoic acid
InChIKeyAFGCRUGTZPDWSF-BYPYZUCNSA-N
SMILESCCOC[C@@H](C(=O)O)N

Computed by PubChem (NCBI)