CAS 474023-97-7 appears in our catalog under these names: O-(tert-Butyldimethylsilyl)-L-homoserine, 97%, 97%, O–(tert–Butyldimethylsilyl)–L–homoserine, O-(tert-Butyldimethylsilyl)-L-homoserine, 95%. Offered by: Chemat, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2S)-2-amino-4-[tert-butyl(dimethyl)silyl]oxybutanoic acid (CAS 474023-97-7) is a chemical compound with the molecular formula C10H23NO3Si and a molecular weight of 233.38 g/mol. IUPAC name: (2S)-2-amino-4-[tert-butyl(dimethyl)silyl]oxybutanoic acid. InChIKey: BKFGDICOIJEWPX-QMMMGPOBSA-N.
| Molecular formula | C10H23NO3Si |
|---|---|
| Molecular weight | 233.38 g/mol |
| IUPAC name | (2S)-2-amino-4-[tert-butyl(dimethyl)silyl]oxybutanoic acid |
| InChIKey | BKFGDICOIJEWPX-QMMMGPOBSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)