CAS 98642-63-8 is the registry number for Methyl (R)-2-Amino-3-[(tert-butyldimethylsilyl)oxy]propanoate, >95%, >95%. Offered by: Chemat. Available pack sizes: 5g.
Methyl (2R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate (CAS 98642-63-8) is a chemical compound with the molecular formula C10H23NO3Si and a molecular weight of 233.38 g/mol. IUPAC name: methyl (2R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate. InChIKey: OIHAQZUILYXJTJ-MRVPVSSYSA-N.
| Molecular formula | C10H23NO3Si |
|---|---|
| Molecular weight | 233.38 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate |
| InChIKey | OIHAQZUILYXJTJ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](C(=O)OC)N |
Computed by PubChem (NCBI)