CAS 71989-43-0 appears in our catalog under these names: H–Thr(tBu)–OMe·HCl, H-L-Thr(tBu)-OMe*HCl, O-tert-Butyl-L-threonine methyl ester hydrochloride, 95% , Methyl O-(tert-butyl)-L-threoninate hydrochloride, 98%, 98%, H-Thr(tBu)-OMe.HCl, 98.0%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g, 10 g, 100 g.
Methyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate;hydrochloride (CAS 71989-43-0) is a chemical compound with the molecular formula C9H20ClNO3 and a molecular weight of 225.71 g/mol. IUPAC name: methyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate;hydrochloride. InChIKey: SDHKEUUZUMQSAD-HHQFNNIRSA-N.
| Molecular formula | C9H20ClNO3 |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | methyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate;hydrochloride |
| InChIKey | SDHKEUUZUMQSAD-HHQFNNIRSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)N)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)