CAS 2375249-55-9 is the registry number for tert-Butyl (2S,3R)-2-amino-3-methoxybutanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Tert-butyl (2S,3R)-2-amino-3-methoxybutanoate;hydrochloride (CAS 2375249-55-9) is a chemical compound with the molecular formula C9H20ClNO3 and a molecular weight of 225.71 g/mol. IUPAC name: tert-butyl (2S,3R)-2-amino-3-methoxybutanoate;hydrochloride. InChIKey: ZTTPZRGPFJQECP-HHQFNNIRSA-N.
| Molecular formula | C9H20ClNO3 |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | tert-butyl (2S,3R)-2-amino-3-methoxybutanoate;hydrochloride |
| InChIKey | ZTTPZRGPFJQECP-HHQFNNIRSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC(C)(C)C)N)OC.Cl |
Computed by PubChem (NCBI)