cas: 468061-05-4 — see every product listed under this CAS number, including other names
H-cis-D-3-OH-Pro-OH·HCl 95% (CAS 468061-05-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A619666-5g |
| cas | 468061-05-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 14632.62 Pln | |
| Ambeed | 100mg | 754.19 Pln | |
| Ambeed | 250mg | 1260.38 Pln | |
| Ambeed | 1g | 3707.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A619666 |
(2R,3S)-3-hydroxypyrrolidine-2-carboxylic acid;hydrochloride (CAS 468061-05-4) is a chemical compound with the molecular formula C5H10ClNO3 and a molecular weight of 167.59 g/mol. IUPAC name: (2R,3S)-3-hydroxypyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: HHFGQFQJUWOFCN-RFKZQXLXSA-N.
| Molecular formula | C5H10ClNO3 |
|---|---|
| Molecular weight | 167.59 g/mol |
| IUPAC name | (2R,3S)-3-hydroxypyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | HHFGQFQJUWOFCN-RFKZQXLXSA-N |
| SMILES | C1CN[C@H]([C@H]1O)C(=O)O.Cl |
Computed by PubChem (NCBI)