CAS 52065-79-9 appears in our catalog under these names: 5-Amino-4-oxopentanoic-5-13C acid hydrochloride, 98%, 5-Aminolevulinic acid-5-13C hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 100mg.
5-amino-4-oxo(513C)pentanoic acid;hydrochloride (CAS 52065-79-9) is a chemical compound with the molecular formula C5H10ClNO3 and a molecular weight of 168.58 g/mol. IUPAC name: 5-amino-4-oxo(513C)pentanoic acid;hydrochloride. InChIKey: ZLHFONARZHCSET-FJUFCODESA-N.
| Molecular formula | C5H10ClNO3 |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 5-amino-4-oxo(513C)pentanoic acid;hydrochloride |
| InChIKey | ZLHFONARZHCSET-FJUFCODESA-N |
| SMILES | C(CC(=O)O)C(=O)[13CH2]N.Cl |
Computed by PubChem (NCBI)