CAS 877768-84-8 appears in our catalog under these names: H2-Gamendazole/ 97.36% (existing batch purity), H2–Gamendazole, H2-Gamendazole, H2-Gamendazole, 98.20%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg.
3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)indazol-3-yl]propanoic acid (CAS 877768-84-8) is a chemical compound with the molecular formula C18H13Cl2F3N2O2 and a molecular weight of 417.2 g/mol. IUPAC name: 3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)indazol-3-yl]propanoic acid. InChIKey: OMVYOEVUBVQVKZ-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl2F3N2O2 |
|---|---|
| Molecular weight | 417.2 g/mol |
| IUPAC name | 3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)indazol-3-yl]propanoic acid |
| InChIKey | OMVYOEVUBVQVKZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N(N=C2CCC(=O)O)CC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)