CAS 139262-76-3 appears in our catalog under these names: H2L5186303, H2L5186303/ 97.23% (existing batch purity), H2L5186303 97%, (2Z,2'Z)-4,4'-(((1,3-Phenylenebis(oxy))bis(4,1-phenylene))bis(azanediyl))bis(4-oxobut-2-enoic acid), 97%, 97%, H2L5186303, 98.24%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 1mg, 50mg, 100mg, 500mg.
(Z)-4-[4-[3-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenoxy]phenoxy]anilino]-4-oxobut-2-enoic acid (CAS 139262-76-3) is a chemical compound with the molecular formula C26H20N2O8 and a molecular weight of 488.4 g/mol. IUPAC name: (Z)-4-[4-[3-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenoxy]phenoxy]anilino]-4-oxobut-2-enoic acid. InChIKey: HZFPOTBCYPWQSH-DZDAAMPGSA-N.
| Molecular formula | C26H20N2O8 |
|---|---|
| Molecular weight | 488.4 g/mol |
| IUPAC name | (Z)-4-[4-[3-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenoxy]phenoxy]anilino]-4-oxobut-2-enoic acid |
| InChIKey | HZFPOTBCYPWQSH-DZDAAMPGSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)NC(=O)/C=C\C(=O)O)OC3=CC=C(C=C3)NC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)