CAS 957011-15-3 appears in our catalog under these names: HBF-0259/ 99.88% (existing batch purity), HBF–0259, HBF-0259, HBF-0259, 99.99%, HBF-0259 (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
7-(2-chloro-6-fluorophenyl)-5-(4-chlorophenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine (CAS 957011-15-3) is a chemical compound with the molecular formula C16H12Cl2FN5 and a molecular weight of 364.2 g/mol. IUPAC name: 7-(2-chloro-6-fluorophenyl)-5-(4-chlorophenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine. InChIKey: BRBZPYDLUUWBCD-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2FN5 |
|---|---|
| Molecular weight | 364.2 g/mol |
| IUPAC name | 7-(2-chloro-6-fluorophenyl)-5-(4-chlorophenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
| InChIKey | BRBZPYDLUUWBCD-UHFFFAOYSA-N |
| SMILES | C1C(NC2=NN=NN2C1C3=C(C=CC=C3Cl)F)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)