CAS 1426944-49-1 appears in our catalog under these names: HBX 19818/ 98.76% (existing batch purity), HBX 19818, HBX 19818, 98%, 98%, HBX 19818, 99.25%, HBX 19818, 98%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 100 mg.
N-[3-[benzyl(methyl)amino]propyl]-9-chloro-5,6,7,8-tetrahydroacridine-2-carboxamide (CAS 1426944-49-1) is a chemical compound with the molecular formula C25H28ClN3O and a molecular weight of 422.0 g/mol. IUPAC name: N-[3-[benzyl(methyl)amino]propyl]-9-chloro-5,6,7,8-tetrahydroacridine-2-carboxamide. InChIKey: ZCALMLVWZSQGGR-UHFFFAOYSA-N.
| Molecular formula | C25H28ClN3O |
|---|---|
| Molecular weight | 422.0 g/mol |
| IUPAC name | N-[3-[benzyl(methyl)amino]propyl]-9-chloro-5,6,7,8-tetrahydroacridine-2-carboxamide |
| InChIKey | ZCALMLVWZSQGGR-UHFFFAOYSA-N |
| SMILES | CN(CCCNC(=O)C1=CC2=C(C=C1)N=C3CCCCC3=C2Cl)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)