CAS 924296-39-9 appears in our catalog under these names: HBX 41108/ 99.13% (existing batch purity), HBX 41108, HBX 41108, 7-Chloro-9-oxo-9H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 99%, 99%, HBX 41108, 98.91%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg.
7-chloro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (CAS 924296-39-9) is a chemical compound with the molecular formula C13H3ClN4O and a molecular weight of 266.64 g/mol. IUPAC name: 7-chloro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile. InChIKey: BIGPXXAUSQLTQR-UHFFFAOYSA-N.
| Molecular formula | C13H3ClN4O |
|---|---|
| Molecular weight | 266.64 g/mol |
| IUPAC name | 7-chloro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| InChIKey | BIGPXXAUSQLTQR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)C3=NC(=C(N=C23)C#N)C#N |
Computed by PubChem (NCBI)