Products 1628291-95-1
CAS 1628291-95-1 appears in our catalog under these names: HC-070/ 97.06% (existing batch purity), HC–070, HC-070, HC-070 98%, HC-070, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione (CAS 1628291-95-1) is a chemical compound with the molecular formula C22H20Cl2N4O4 and a molecular weight of 475.3 g/mol. IUPAC name: 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione. InChIKey: VYJPVPHNGWEIBT-UHFFFAOYSA-N.
| Molecular formula | C22H20Cl2N4O4 |
|---|---|
| Molecular weight | 475.3 g/mol |
| IUPAC name | 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione |
| InChIKey | VYJPVPHNGWEIBT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)CCCO)N(C(=N2)OC3=CC(=CC=C3)Cl)CC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)
Synonyms:
orb1308232