CAS 1998705-62-6 appears in our catalog under these names: HCV–IN–31, HCV-IN-31/ 99.95% (existing batch purity), HCV-IN-31, HCV-IN-31 98%, (2′R)-2-Amino-2′-deoxy-2′-fluoro-N,2′-dimethyladenosine, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 100mg, 250mg.
(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (CAS 1998705-62-6) is a chemical compound with the molecular formula C12H17FN6O3 and a molecular weight of 312.30 g/mol. IUPAC name: (2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol. InChIKey: HPINXBYYNVDDEB-GSWPYSDESA-N.
| Molecular formula | C12H17FN6O3 |
|---|---|
| Molecular weight | 312.30 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| InChIKey | HPINXBYYNVDDEB-GSWPYSDESA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)N)NC)CO)O)F |
Computed by PubChem (NCBI)