cas: 161308-36-7 — see every product listed under this CAS number, including other names
HEPBS, 99.00% (CAS 161308-36-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM19380K-100g |
| cas | 161308-36-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 1723.10 Pln | |
| Chemat | 25g | 674.59 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.00% |
| category | Chemicals |
4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid (CAS 161308-36-7) is a chemical compound with the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. IUPAC name: 4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid. InChIKey: LOJNFONOHINEFI-UHFFFAOYSA-N.
| Molecular formula | C10H22N2O4S |
|---|---|
| Molecular weight | 266.36 g/mol |
| IUPAC name | 4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid |
| InChIKey | LOJNFONOHINEFI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCCS(=O)(=O)O)CCO |
Computed by PubChem (NCBI)