CAS 161308-36-7 appears in our catalog under these names: N-(2-Hydroxyethyl)piperazine-n'-(4-butanesulfonic acid), 97%, HEPBS/ 100%, HEPBS, HEPBS, 99.00%, HEPBS 97%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 0,05kg, 0,1kg, 0,25kg, 1kg.
4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid (CAS 161308-36-7) is a chemical compound with the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. IUPAC name: 4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid. InChIKey: LOJNFONOHINEFI-UHFFFAOYSA-N.
| Molecular formula | C10H22N2O4S |
|---|---|
| Molecular weight | 266.36 g/mol |
| IUPAC name | 4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid |
| InChIKey | LOJNFONOHINEFI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCCS(=O)(=O)O)CCO |
Computed by PubChem (NCBI)