CAS 2851993-91-2 appears in our catalog under these names: HHS-0701/ 97.24% (existing batch purity), HHS–0701, (4-Phenyl-1-piperidinyl)[4-(1H-1,2,4-triazol-1-ylsulfonyl)phenyl]methanone, HHS-0701, 98.90%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg, 2mg.
(4-phenylpiperidin-1-yl)-[4-(1,2,4-triazol-1-ylsulfonyl)phenyl]methanone (CAS 2851993-91-2) is a chemical compound with the molecular formula C20H20N4O3S and a molecular weight of 396.5 g/mol. IUPAC name: (4-phenylpiperidin-1-yl)-[4-(1,2,4-triazol-1-ylsulfonyl)phenyl]methanone. InChIKey: LLBIFOHOSLRVRY-UHFFFAOYSA-N.
| Molecular formula | C20H20N4O3S |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | (4-phenylpiperidin-1-yl)-[4-(1,2,4-triazol-1-ylsulfonyl)phenyl]methanone |
| InChIKey | LLBIFOHOSLRVRY-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2=CC=CC=C2)C(=O)C3=CC=C(C=C3)S(=O)(=O)N4C=NC=N4 |
Computed by PubChem (NCBI)