HO-PEG(24)-CO-tbu 95% PEG(24)
cas: 1186025-29-5 — see every product listed under this CAS number, including other names
HO-PEG(24)-CO-tbu 95% PEG(24) (CAS 1186025-29-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A986392-100mg |
| cas | 1186025-29-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 1243.69 Pln | |
| Ambeed | 1g | 2333.94 Pln | |
| Ambeed | 5g | 11378.56 Pln |
properties
| purity | 95% PEG(24) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A986392 |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1186025-29-5) is a chemical compound with the molecular formula C55H110O27 and a molecular weight of 1203.4 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: YMILISGQCISYOH-UHFFFAOYSA-N.
| Molecular formula | C55H110O27 |
|---|---|
| Molecular weight | 1203.4 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | YMILISGQCISYOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)
Synonyms:
Hydroxy-PEG24-t-butyl ester, Ho-peg(24)-co-tbu, Hydroxy-PEG24-Boc, HO-PEG24-CH2CH2COOtBu, alpha-[3-(1,1-Dimethylethoxy)-3-oxopropyl]-omega-hydroxypoly(oxy-1,2-ethanediyl), 4-TFP Ester, Hydroxy-PEG11-t-butly ester, Hydroxy-PEG17-t-butyl ester, OH-PEG24-CH2CH2COOtBu, Hydroxy-dPEG24-t-butyl ester