alpha-[3-(1,1-Dimethylethoxy)-3-oxopropyl]-omega-hydroxypoly(oxy-1,2-ethanediyl), 95%, 95%
cas: 1186025-29-5 — see every product listed under this CAS number, including other names
alpha-[3-(1,1-Dimethylethoxy)-3-oxopropyl]-omega-hydroxypoly(oxy-1,2-ethanediyl), 95%, 95% (CAS 1186025-29-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11022R-100mg |
| cas | 1186025-29-5 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 942.80 Pln | |
| Chemat | 500mg | 1566.80 Pln | |
| Chemat | 1g | 2416.40 Pln | |
| Chemat | 5g | 8834.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1186025-29-5) is a chemical compound with the molecular formula C55H110O27 and a molecular weight of 1203.4 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: YMILISGQCISYOH-UHFFFAOYSA-N.
| Molecular formula | C55H110O27 |
|---|---|
| Molecular weight | 1203.4 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | YMILISGQCISYOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)
Synonyms:
Hydroxy-PEG24-t-butyl ester, Ho-peg(24)-co-tbu, Hydroxy-PEG24-Boc, HO-PEG24-CH2CH2COOtBu, alpha-[3-(1,1-Dimethylethoxy)-3-oxopropyl]-omega-hydroxypoly(oxy-1,2-ethanediyl), 4-TFP Ester, Hydroxy-PEG11-t-butly ester, Hydroxy-PEG17-t-butyl ester, OH-PEG24-CH2CH2COOtBu, Hydroxy-dPEG24-t-butyl ester