cas: 52026-48-9 — see every product listed under this CAS number, including other names
HO-PEG5-CH2COOH 95% (CAS 52026-48-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A700467-10g |
| cas | 52026-48-9 |
| size | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 8452.69 Pln | |
| Ambeed | 50mg | 236.88 Pln | |
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1416.12 Pln | |
| Ambeed | 5g | 5309.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A700467 |
2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 52026-48-9) is a chemical compound with the molecular formula C12H24O8 and a molecular weight of 296.31 g/mol. IUPAC name: 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: SXGGZTBEWZFLBZ-UHFFFAOYSA-N.
| Molecular formula | C12H24O8 |
|---|---|
| Molecular weight | 296.31 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | SXGGZTBEWZFLBZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCC(=O)O)O |
Computed by PubChem (NCBI)