CAS 52026-48-9 appears in our catalog under these names: HO–PEG5–CH2COOH, HO-PEG5-CH2COOH 95%, 3,6,9,12,15-Pentaoxaheptadecanoic acid, 17-hydroxy-, 95%, 95%, HO-PEG5-CH2COOH. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 10g, 50mg, 5g, 1 g, 50 mg.
2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 52026-48-9) is a chemical compound with the molecular formula C12H24O8 and a molecular weight of 296.31 g/mol. IUPAC name: 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: SXGGZTBEWZFLBZ-UHFFFAOYSA-N.
| Molecular formula | C12H24O8 |
|---|---|
| Molecular weight | 296.31 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | SXGGZTBEWZFLBZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCC(=O)O)O |
Computed by PubChem (NCBI)