cas: 307-78-8 — see every product listed under this CAS number, including other names
Hexadecafluorosebacic Acid, >96.0%(GC)(T) (CAS 307-78-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H0892-5G |
| cas | 307-78-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 472.39 Pln | |
| TCI | 25g | 2168.84 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC)(T) |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioic acid (CAS 307-78-8) is a chemical compound with the molecular formula C10H2F16O4 and a molecular weight of 490.09 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioic acid. InChIKey: YPCSMEGZIYWAAZ-UHFFFAOYSA-N.
| Molecular formula | C10H2F16O4 |
|---|---|
| Molecular weight | 490.09 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioic acid |
| InChIKey | YPCSMEGZIYWAAZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)