CAS 307-78-8 appears in our catalog under these names: Hexadecafluorosebacic acid, 95%, Hexadecafluorosebacic Acid, Hexadecafluorosebacic Acid, >96.0%(GC)(T), PERFLUOROSEBACIC ACID, Hexadecafluorosebacic acid, 96%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioic acid (CAS 307-78-8) is a chemical compound with the molecular formula C10H2F16O4 and a molecular weight of 490.09 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioic acid. InChIKey: YPCSMEGZIYWAAZ-UHFFFAOYSA-N.
| Molecular formula | C10H2F16O4 |
|---|---|
| Molecular weight | 490.09 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioic acid |
| InChIKey | YPCSMEGZIYWAAZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)