Hexadecanedioic acid, 97%
cas: 505-54-4 — see every product listed under this CAS number, including other names
Hexadecanedioic acid, 97% (CAS 505-54-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 5kg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A296732-250mg |
| cas | 505-54-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 303.62 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 184.40 Pln | |
| Chemat | 500g | 734.40 Pln | |
| Chemat | 5kg | 5265.60 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 10g | 169.96 Pln | |
| BLDpharm | 25g | 197.73 Pln | |
| BLDpharm | 100g | 269.93 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Hexadecanedioic acid is an alpha,-dicarboxylic acid that is the 1,14-dicarboxy derivative of tetradecane. It has a role as a human metabolite. It is a dicarboxylic fatty acid and an alpha,omega-dicarboxylic acid. It is a conjugate acid of a hexadecanedioate(2-).
Source: ChEBI
| Molecular formula | C16H30O4 |
|---|---|
| Molecular weight | 286.41 g/mol |
| IUPAC name | hexadecanedioic acid |
| InChIKey | QQHJDPROMQRDLA-UHFFFAOYSA-N |
| SMILES | C(CCCCCCCC(=O)O)CCCCCCC(=O)O |
Computed by PubChem (NCBI)
