Products 16090-77-0
CAS 16090-77-0 appears in our catalog under these names: Dibutyl Suberate, Suberic acid di-n-butyl ester, Suberic acid di-n-butyl ester, min. 90 %, 100 g, Suberic acid di-n-butyl ester, min. 90 %, 250 g, Suberic acid di-n-butyl ester, min. 90 %, 500 g. Offered by: TRC, Biosynth, Roth. Available pack sizes: 1g, 0,25kg, 0,1kg, 0,5kg, 1kg, 100g, 250g, 500g.
Dibutyl octanedioate (CAS 16090-77-0) is a chemical compound with the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. IUPAC name: dibutyl octanedioate. InChIKey: LBXQUCHUHCBNTC-UHFFFAOYSA-N.
| Molecular formula | C16H30O4 |
|---|---|
| Molecular weight | 286.41 g/mol |
| IUPAC name | dibutyl octanedioate |
| InChIKey | LBXQUCHUHCBNTC-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CCCCCCC(=O)OCCCC |
Computed by PubChem (NCBI)