cas: 23491-44-3 — see every product listed under this CAS number, including other names
Hoechst 33258, 98%, 98% (CAS 23491-44-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EN2Y-25mg |
| cas | 23491-44-3 |
| size | 25mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 203.60 Pln | |
| Chemat | 50mg | 299.60 Pln | |
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 890.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Pibenzimol is a bibenzimidazole and a N-methylpiperazine. It has a role as an anthelminthic drug and a fluorochrome.
Source: ChEBI
| Molecular formula | C25H24N6O |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | 4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenol |
| InChIKey | INAAIJLSXJJHOZ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC=C(C=C6)O |
Computed by PubChem (NCBI)