CAS 23491-44-3 appears in our catalog under these names: Hoechst 33258, 97%, Hoechst 33258, Hoechst 33258, 98%, 98%, Hoechst 33258, 99.93%, Hoechst 33258, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10mM (in 1ml dmso), 50mg, 25mg, 100 mg, 50 mg.
Pibenzimol is a bibenzimidazole and a N-methylpiperazine. It has a role as an anthelminthic drug and a fluorochrome.
Source: ChEBI
| Molecular formula | C25H24N6O |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | 4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenol |
| InChIKey | INAAIJLSXJJHOZ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC=C(C=C6)O |
Computed by PubChem (NCBI)