CAS 1805818-57-8 appears in our catalog under these names: 4-(5-Chloro-2-ethoxy-4-fluorobenzamido)-3,3-dimethylbutanoic acid, 97%, Hydrazinium hydroxide/ 99.63% (existing batch purity), 4-(5-Chloro-2-ethoxy-4-fluorobenzamido)-3,3-dimethylbutanoic acid, 95%, 95%, 4-(5-Chloro-2-ethoxy-4-fluorobenzamido)-3,3-dimethylbutanoic acid, 95%. Offered by: AmBeed, TargetMol, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
4-[(5-chloro-2-ethoxy-4-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid (CAS 1805818-57-8) is a chemical compound with the molecular formula C15H19ClFNO4 and a molecular weight of 331.76 g/mol. IUPAC name: 4-[(5-chloro-2-ethoxy-4-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid. InChIKey: DKDKMQXGRYLKSZ-UHFFFAOYSA-N.
| Molecular formula | C15H19ClFNO4 |
|---|---|
| Molecular weight | 331.76 g/mol |
| IUPAC name | 4-[(5-chloro-2-ethoxy-4-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid |
| InChIKey | DKDKMQXGRYLKSZ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1C(=O)NCC(C)(C)CC(=O)O)Cl)F |
Computed by PubChem (NCBI)