CAS 850090-09-4 appears in our catalog under these names: Hydroxy-peg-5-t-butyl ester, 95%, Hydroxy-PEG5-Boc/ min. 98%, Hydroxy–PEG5–Boc, 4,7,10,13,16-Pentaoxaoctadecanoic acid, 18-hydroxy-, 1,1-dimethylethyl ester, 98%, 98%, Hydroxy-PEG5-Boc, 99.09%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, 25mg, 100mg, 10g, 25g, 50g.
Tert-butyl 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 850090-09-4) is a chemical compound with the molecular formula C17H34O8 and a molecular weight of 366.4 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: SNYKXOAOLAFMRH-UHFFFAOYSA-N.
| Molecular formula | C17H34O8 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | SNYKXOAOLAFMRH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)