Hydroxy-PEG6-acid 95%
cas: 1347750-85-9 — see every product listed under this CAS number, including other names
Hydroxy-PEG6-acid 95% (CAS 1347750-85-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A750803-250mg |
| cas | 1347750-85-9 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1538.50 Pln | |
| Ambeed | 10g | 2740.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A750803 |
3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1347750-85-9) is a chemical compound with the molecular formula C15H30O9 and a molecular weight of 354.39 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: LGLHJMFNIHYJBM-UHFFFAOYSA-N.
| Molecular formula | C15H30O9 |
|---|---|
| Molecular weight | 354.39 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | LGLHJMFNIHYJBM-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCO)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Hydroxy-PEG6-acid, Hydroxy-PEG6-propionic acid, Propanoic acid, 3-[(17-hydroxy-3,6,9,12,15-pentaoxaheptadec-1-yl)oxy]-, 3-[(17-Hydroxy-3,6,9,12,15-pentaoxaheptadec-1-yl)oxy]propanoic acid, 3-[(17-hydroxy-3,6,9,12,15-pentaoxaheptadec-1-yl)oxy]-propanoic acid, HO-PEG7-acid, orb1989221, a-hydroxy-?-propionic acid hexaethylene glycol, Alpha-hydroxy-Omega-propionic acid hexaethylene glycol