cas: 66117-64-4 — see every product listed under this CAS number, including other names
Hydroxydi-p-tolylborane 98% (CAS 66117-64-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A632102-250mg |
| cas | 66117-64-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1432.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A632102 |
Bis(4-methylphenyl)borinic acid (CAS 66117-64-4) is a chemical compound with the molecular formula C14H15BO and a molecular weight of 210.08 g/mol. IUPAC name: bis(4-methylphenyl)borinic acid. InChIKey: ZJHMSSYDWCPSFN-UHFFFAOYSA-N.
| Molecular formula | C14H15BO |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | bis(4-methylphenyl)borinic acid |
| InChIKey | ZJHMSSYDWCPSFN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C)(C2=CC=C(C=C2)C)O |
Computed by PubChem (NCBI)