CAS 66117-64-4 appears in our catalog under these names: Borinic acid, bis(4-methylphenyl)-, 98%, 98%, Hydroxydip-tolylborane, 98%, Hydroxydi-p-tolylborane, >95% (HPLC), Hydroxydi-p-tolylborane 98%. Offered by: Chemat, Combi-blocks, TRC, Ambeed. Available pack sizes: 5g, 250mg, 1g, 25g, 500mg, 50mg.
Bis(4-methylphenyl)borinic acid (CAS 66117-64-4) is a chemical compound with the molecular formula C14H15BO and a molecular weight of 210.08 g/mol. IUPAC name: bis(4-methylphenyl)borinic acid. InChIKey: ZJHMSSYDWCPSFN-UHFFFAOYSA-N.
| Molecular formula | C14H15BO |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | bis(4-methylphenyl)borinic acid |
| InChIKey | ZJHMSSYDWCPSFN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C)(C2=CC=C(C=C2)C)O |
Computed by PubChem (NCBI)