CAS 107019-95-4 appears in our catalog under these names: Hymenidin/ 98.05% (existing batch purity), Hymenidin. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 1mg, Get quote.
N-[(E)-3-(2-amino-1H-imidazol-5-yl)prop-2-enyl]-4-bromo-1H-pyrrole-2-carboxamide (CAS 107019-95-4) is a chemical compound with the molecular formula C11H12BrN5O and a molecular weight of 310.15 g/mol. IUPAC name: N-[(E)-3-(2-amino-1H-imidazol-5-yl)prop-2-enyl]-4-bromo-1H-pyrrole-2-carboxamide. InChIKey: KHJREOQCERRAME-OWOJBTEDSA-N.
| Molecular formula | C11H12BrN5O |
|---|---|
| Molecular weight | 310.15 g/mol |
| IUPAC name | N-[(E)-3-(2-amino-1H-imidazol-5-yl)prop-2-enyl]-4-bromo-1H-pyrrole-2-carboxamide |
| InChIKey | KHJREOQCERRAME-OWOJBTEDSA-N |
| SMILES | C1=C(NC=C1Br)C(=O)NC/C=C/C2=CN=C(N2)N |
Computed by PubChem (NCBI)