cas: 1022150-12-4 — see every product listed under this CAS number, including other names
IBT6A 98% (CAS 1022150-12-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 50mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A110162-1mg |
| cas | 1022150-12-4 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 153.44 Pln | |
| Ambeed | 2mg | 175.69 Pln | |
| Ambeed | 5mg | 197.94 Pln | |
| Ambeed | 10mg | 220.19 Pln | |
| Ambeed | 50mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 10g | 804.25 Pln | |
| Ambeed | 25g | 1538.50 Pln | |
| Ambeed | 100g | 4469.94 Pln | |
| Ambeed | 500g | 17669.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A110162 |
3-(4-phenoxyphenyl)-1-[(3R)-piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine (CAS 1022150-12-4) is a chemical compound with the molecular formula C22H22N6O and a molecular weight of 386.4 g/mol. IUPAC name: 3-(4-phenoxyphenyl)-1-[(3R)-piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: GPSQYTDPBDNDGI-MRXNPFEDSA-N.
| Molecular formula | C22H22N6O |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 3-(4-phenoxyphenyl)-1-[(3R)-piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | GPSQYTDPBDNDGI-MRXNPFEDSA-N |
| SMILES | C1C[C@H](CNC1)N2C3=NC=NC(=C3C(=N2)C4=CC=C(C=C4)OC5=CC=CC=C5)N |
Computed by PubChem (NCBI)