CAS 1412418-47-3 appears in our catalog under these names: 3-(4-Phenoxyphenyl)-1-(piperidin-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine, (Rac)-IBT6A, 98+%, (Rac)-IBT6A/ 98.68% (existing batch purity), (Rac)-IBT6A, (Rac)-IBT6A 98+%. Offered by: Chemat, AmBeed, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 2mg, 250mg.
3-(4-phenoxyphenyl)-1-piperidin-3-ylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 1412418-47-3) is a chemical compound with the molecular formula C22H22N6O and a molecular weight of 386.4 g/mol. IUPAC name: 3-(4-phenoxyphenyl)-1-piperidin-3-ylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: GPSQYTDPBDNDGI-UHFFFAOYSA-N.
| Molecular formula | C22H22N6O |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 3-(4-phenoxyphenyl)-1-piperidin-3-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | GPSQYTDPBDNDGI-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)N2C3=NC=NC(=C3C(=N2)C4=CC=C(C=C4)OC5=CC=CC=C5)N |
Computed by PubChem (NCBI)