CAS 325457-89-4 appears in our catalog under these names: ICA-27243/ 99.79% (existing batch purity), ICA–27243, N-(6-Chloropyridin-3-yl)-3,4-difluorobenzamide, 98%, 98%, ICA-27243, 99.27%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
N-(6-chloro-3-pyridinyl)-3,4-difluorobenzamide (CAS 325457-89-4) is a chemical compound with the molecular formula C12H7ClF2N2O and a molecular weight of 268.64 g/mol. IUPAC name: N-(6-chloro-3-pyridinyl)-3,4-difluorobenzamide. InChIKey: GDGUOCFTHNGPBK-UHFFFAOYSA-N.
| Molecular formula | C12H7ClF2N2O |
|---|---|
| Molecular weight | 268.64 g/mol |
| IUPAC name | N-(6-chloro-3-pyridinyl)-3,4-difluorobenzamide |
| InChIKey | GDGUOCFTHNGPBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NC2=CN=C(C=C2)Cl)F)F |
Computed by PubChem (NCBI)