CAS 914471-09-3 appears in our catalog under these names: INCB024360, IDO5L/ 100%, INCB024360 analogue, IDO5L 99%, IDO5L, 99.89%. Offered by: TRC, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 500mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 10mM (in 1ml dmso).
4-amino-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (CAS 914471-09-3) is a chemical compound with the molecular formula C9H7ClFN5O2 and a molecular weight of 271.63 g/mol. IUPAC name: 4-amino-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide. InChIKey: HGXSLPIXNPASGZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFN5O2 |
|---|---|
| Molecular weight | 271.63 g/mol |
| IUPAC name | 4-amino-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| InChIKey | HGXSLPIXNPASGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C(C2=NON=C2N)NO)Cl)F |
Computed by PubChem (NCBI)