CAS 548779-60-8 appears in our catalog under these names: IHR-1/ 98.6% (existing batch purity), IHR 1, IHR-1, IHR-1 99%, N,N'-(1,4-Phenylene)bis(2,5-dichlorobenzamide), 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2,5-dichloro-N-[4-[(2,5-dichlorobenzoyl)amino]phenyl]benzamide (CAS 548779-60-8) is a chemical compound with the molecular formula C20H12Cl4N2O2 and a molecular weight of 454.1 g/mol. IUPAC name: 2,5-dichloro-N-[4-[(2,5-dichlorobenzoyl)amino]phenyl]benzamide. InChIKey: VCLHHRGZKNUOAQ-UHFFFAOYSA-N.
| Molecular formula | C20H12Cl4N2O2 |
|---|---|
| Molecular weight | 454.1 g/mol |
| IUPAC name | 2,5-dichloro-N-[4-[(2,5-dichlorobenzoyl)amino]phenyl]benzamide |
| InChIKey | VCLHHRGZKNUOAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C2=C(C=CC(=C2)Cl)Cl)NC(=O)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)