CAS 2563892-44-2 appears in our catalog under these names: IK-930/ 98.86% (existing batch purity), IK–930, IK-930 99%, N-Methyl-3-(1-methyl-1H-imidazol-4-yl)-4-[[[4-(trifluoromethyl)phenyl]methyl]amino]benzenesulfonamide, 99%, 99%, IK-930, 99.39%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg, 5 mg.
N-methyl-3-(1-methylimidazol-4-yl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide (CAS 2563892-44-2) is a chemical compound with the molecular formula C19H19F3N4O2S and a molecular weight of 424.4 g/mol. IUPAC name: N-methyl-3-(1-methylimidazol-4-yl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide. InChIKey: TVBGCXJDLVRDSU-UHFFFAOYSA-N.
| Molecular formula | C19H19F3N4O2S |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | N-methyl-3-(1-methylimidazol-4-yl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
| InChIKey | TVBGCXJDLVRDSU-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=C(C=C1)NCC2=CC=C(C=C2)C(F)(F)F)C3=CN(C=N3)C |
Computed by PubChem (NCBI)